C25H26N6O2 — CID 159373075
6-oxa-1,11,22,25,26,28-hexazapentacyclo[19.5.2.22,5.216,19.024,27]dotriaconta-2(32),3,5(31),16(30),17,19(29),21,23,25,27-decaen-12-one (PubChem CID 159373075) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 6-oxa-1,11,22,25,26,28-hexazapentacyclo[19.5.2.22,5.216,19.024,27]dotriaconta-2(32),3,5(31),16(30),17,19(29),21,23,25,27-decaen-12-one.
| Compound Name | 6-oxa-1,11,22,25,26,28-hexazapentacyclo[19.5.2.22,5.216,19.024,27]dotriaconta-2(32),3,5(31),16(30),17,19(29),21,23,25,27-decaen-12-one |
|---|---|
| PubChem CID | 159373075 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 6-oxa-1,11,22,25,26,28-hexazapentacyclo[19.5.2.22,5.216,19.024,27]dotriaconta-2(32),3,5(31),16(30),17,19(29),21,23,25,27-decaen-12-one |
| SMILES | O=C1CCCc2ccc(cc2)Cc2ncc3nnn(c3n2)-c2ccc(cc2)OCCCCN1 |
| InChI | InChI=1S/C25H26N6O2/c32-24-5-3-4-18-6-8-19(9-7-18)16-23-27-17-22-25(28-23)31(30-29-22)20-10-12-21(13-11-20)33-15-2-1-14-26-24/h6-13,17H,1-5,14-16H2,(H,26,32) |
| InChIKey | LJZCLUJKXPLOKH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |