C29H38N10O2 — CID 137203784
6-oxa-1,11,15,18,24,27,29,32,33,35-decazahexacyclo[26.5.2.22,5.215,18.121,26.031,34]tetraconta-2(40),3,5(39),24,26(36),28,30,32,34-nonaen-10-one (PubChem CID 137203784) has the molecular formula C29H38N10O2 and a molecular weight of 558.69 g/mol. Its IUPAC name is 6-oxa-1,11,15,18,24,27,29,32,33,35-decazahexacyclo[26.5.2.22,5.215,18.121,26.031,34]tetraconta-2(40),3,5(39),24,26(36),28,30,32,34-nonaen-10-one.
| Compound Name | 6-oxa-1,11,15,18,24,27,29,32,33,35-decazahexacyclo[26.5.2.22,5.215,18.121,26.031,34]tetraconta-2(40),3,5(39),24,26(36),28,30,32,34-nonaen-10-one |
|---|---|
| PubChem CID | 137203784 |
| Molecular Formula | C29H38N10O2 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 6-oxa-1,11,15,18,24,27,29,32,33,35-decazahexacyclo[26.5.2.22,5.215,18.121,26.031,34]tetraconta-2(40),3,5(39),24,26(36),28,30,32,34-nonaen-10-one |
| SMILES | O=C1CCCOc2ccc(cc2)-n2nnc3cnc(nc32)NC2=CC(CCN=C2)CCN2CCN(CCCN1)CC2 |
| InChI | InChI=1S/C29H38N10O2/c40-27-3-1-18-41-25-6-4-24(5-7-25)39-28-26(35-36-39)21-32-29(34-28)33-23-19-22(8-11-30-20-23)9-13-38-16-14-37(15-17-38)12-2-10-31-27/h4-7,19-22H,1-3,8-18H2,(H,31,40)(H,32,33,34) |
| InChIKey | YMQRTOHYKNNOFT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |