C14H13ClN6O — CID 90397849
(3R)-1-[4-(5-chlorotriazolo[4,5-d]pyrimidin-3-yl)phenyl]pyrrolidin-3-ol (PubChem CID 90397849) has the molecular formula C14H13ClN6O and a molecular weight of 316.75 g/mol. Its IUPAC name is (3R)-1-[4-(5-chlorotriazolo[4,5-d]pyrimidin-3-yl)phenyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[4-(5-chlorotriazolo[4,5-d]pyrimidin-3-yl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 90397849 |
| Molecular Formula | C14H13ClN6O |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (3R)-1-[4-(5-chlorotriazolo[4,5-d]pyrimidin-3-yl)phenyl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(c2ccc(-n3nnc4cnc(Cl)nc43)cc2)C1 |
| InChI | InChI=1S/C14H13ClN6O/c15-14-16-7-12-13(17-14)21(19-18-12)10-3-1-9(2-4-10)20-6-5-11(22)8-20/h1-4,7,11,22H,5-6,8H2/t11-/m1/s1 |
| InChIKey | HRCXZUUGWKFJDX-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|