C23H27FN2O3 — CID 110067071
(7S)-19-(3-fluoro-4-methylphenyl)-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-8-one (PubChem CID 110067071) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is (7S)-19-(3-fluoro-4-methylphenyl)-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-8-one.
| Compound Name | (7S)-19-(3-fluoro-4-methylphenyl)-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-8-one |
|---|---|
| PubChem CID | 110067071 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (7S)-19-(3-fluoro-4-methylphenyl)-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-8-one |
| SMILES | Cc1ccc(-c2ccc3c(c2)CN2CCC[C@H]2C(=O)NCCOCCO3)cc1F |
| InChI | InChI=1S/C23H27FN2O3/c1-16-4-5-18(14-20(16)24)17-6-7-22-19(13-17)15-26-9-2-3-21(26)23(27)25-8-10-28-11-12-29-22/h4-7,13-14,21H,2-3,8-12,15H2,1H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | MDYNBEJMNUVBLH-NRFANRHFSA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |