C26H35N3O3 — CID 110068025
5-[methyl(2-phenylethyl)amino]-9,12-dioxa-1,15-diazatricyclo[15.3.1.03,8]henicosa-3(8),4,6-trien-16-one (PubChem CID 110068025) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 5-[methyl(2-phenylethyl)amino]-9,12-dioxa-1,15-diazatricyclo[15.3.1.03,8]henicosa-3(8),4,6-trien-16-one.
| Compound Name | 5-[methyl(2-phenylethyl)amino]-9,12-dioxa-1,15-diazatricyclo[15.3.1.03,8]henicosa-3(8),4,6-trien-16-one |
|---|---|
| PubChem CID | 110068025 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 5-[methyl(2-phenylethyl)amino]-9,12-dioxa-1,15-diazatricyclo[15.3.1.03,8]henicosa-3(8),4,6-trien-16-one |
| SMILES | CN(CCc1ccccc1)c1ccc2c(c1)CN1CCCC(C1)C(=O)NCCOCCO2 |
| InChI | InChI=1S/C26H35N3O3/c1-28(14-11-21-6-3-2-4-7-21)24-9-10-25-23(18-24)20-29-13-5-8-22(19-29)26(30)27-12-15-31-16-17-32-25/h2-4,6-7,9-10,18,22H,5,8,11-17,19-20H2,1H3,(H,27,30) |
| InChIKey | ZOJRMMVROIINMR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|