C22H33N3O4 — CID 110067507
19-(oxan-4-ylmethylamino)-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-8-one (PubChem CID 110067507) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 19-(oxan-4-ylmethylamino)-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-8-one.
| Compound Name | 19-(oxan-4-ylmethylamino)-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-8-one |
|---|---|
| PubChem CID | 110067507 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 19-(oxan-4-ylmethylamino)-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-8-one |
| SMILES | O=C1NCCOCCOc2ccc(NCC3CCOCC3)cc2CN2CCCC12 |
| InChI | InChI=1S/C22H33N3O4/c26-22-20-2-1-8-25(20)16-18-14-19(24-15-17-5-9-27-10-6-17)3-4-21(18)29-13-12-28-11-7-23-22/h3-4,14,17,20,24H,1-2,5-13,15-16H2,(H,23,26) |
| InChIKey | COGVFHHWMFYEOP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|