C22H28N4O3 — CID 110068022
5-(pyridin-2-ylamino)-9,12-dioxa-1,15-diazatricyclo[15.3.1.03,8]henicosa-3(8),4,6-trien-16-one (PubChem CID 110068022) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 5-(pyridin-2-ylamino)-9,12-dioxa-1,15-diazatricyclo[15.3.1.03,8]henicosa-3(8),4,6-trien-16-one.
| Compound Name | 5-(pyridin-2-ylamino)-9,12-dioxa-1,15-diazatricyclo[15.3.1.03,8]henicosa-3(8),4,6-trien-16-one |
|---|---|
| PubChem CID | 110068022 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 5-(pyridin-2-ylamino)-9,12-dioxa-1,15-diazatricyclo[15.3.1.03,8]henicosa-3(8),4,6-trien-16-one |
| SMILES | O=C1NCCOCCOc2ccc(Nc3ccccn3)cc2CN2CCCC1C2 |
| InChI | InChI=1S/C22H28N4O3/c27-22-17-4-3-10-26(15-17)16-18-14-19(25-21-5-1-2-8-23-21)6-7-20(18)29-13-12-28-11-9-24-22/h1-2,5-8,14,17H,3-4,9-13,15-16H2,(H,23,25)(H,24,27) |
| InChIKey | VMADJMRWVCZDQR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |