C30H38N6O5 — CID 159504693
19-[4-(dimethylamino)butyl]-12-methoxy-14,23-dioxa-2,4,6,17,20-pentazatetracyclo[22.2.2.13,7.19,13]triaconta-1(26),3,5,7(30),9(29),10,12,24,27-nonaene-18,21-dione (PubChem CID 159504693) has the molecular formula C30H38N6O5 and a molecular weight of 562.67 g/mol. Its IUPAC name is 19-[4-(dimethylamino)butyl]-12-methoxy-14,23-dioxa-2,4,6,17,20-pentazatetracyclo[22.2.2.13,7.19,13]triaconta-1(26),3,5,7(30),9(29),10,12,24,27-nonaene-18,21-dione.
| Compound Name | 19-[4-(dimethylamino)butyl]-12-methoxy-14,23-dioxa-2,4,6,17,20-pentazatetracyclo[22.2.2.13,7.19,13]triaconta-1(26),3,5,7(30),9(29),10,12,24,27-nonaene-18,21-dione |
|---|---|
| PubChem CID | 159504693 |
| Molecular Formula | C30H38N6O5 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 19-[4-(dimethylamino)butyl]-12-methoxy-14,23-dioxa-2,4,6,17,20-pentazatetracyclo[22.2.2.13,7.19,13]triaconta-1(26),3,5,7(30),9(29),10,12,24,27-nonaene-18,21-dione |
| SMILES | COc1ccc2cc1OCCNC(=O)C(CCCCN(C)C)NC(=O)COc1ccc(cc1)Nc1cc(ncn1)C2 |
| InChI | InChI=1S/C30H38N6O5/c1-36(2)14-5-4-6-25-30(38)31-13-15-40-27-17-21(7-12-26(27)39-3)16-23-18-28(33-20-32-23)34-22-8-10-24(11-9-22)41-19-29(37)35-25/h7-12,17-18,20,25H,4-6,13-16,19H2,1-3H3,(H,31,38)(H,35,37)(H,32,33,34) |
| InChIKey | LZVIMSCOSCQKSQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|