C20H22N6O5 — CID 59376224
N-hydroxy-2-[2-[[3-(4-methoxyphenyl)-2-oxoimidazol-1-yl]methyl]morpholin-4-yl]pyrimidine-5-carboxamide (PubChem CID 59376224) has the molecular formula C20H22N6O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is N-hydroxy-2-[2-[[3-(4-methoxyphenyl)-2-oxoimidazol-1-yl]methyl]morpholin-4-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[2-[[3-(4-methoxyphenyl)-2-oxoimidazol-1-yl]methyl]morpholin-4-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59376224 |
| Molecular Formula | C20H22N6O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-hydroxy-2-[2-[[3-(4-methoxyphenyl)-2-oxoimidazol-1-yl]methyl]morpholin-4-yl]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(-n2ccn(CC3CN(c4ncc(C(=O)NO)cn4)CCO3)c2=O)cc1 |
| InChI | InChI=1S/C20H22N6O5/c1-30-16-4-2-15(3-5-16)26-7-6-25(20(26)28)13-17-12-24(8-9-31-17)19-21-10-14(11-22-19)18(27)23-29/h2-7,10-11,17,29H,8-9,12-13H2,1H3,(H,23,27) |
| InChIKey | XWDXXMCAGOKYRK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|