C19H20N6O4 — CID 59376181
N-hydroxy-2-[2-[(2-oxo-3-phenylimidazol-1-yl)methyl]morpholin-4-yl]pyrimidine-5-carboxamide (PubChem CID 59376181) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is N-hydroxy-2-[2-[(2-oxo-3-phenylimidazol-1-yl)methyl]morpholin-4-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[2-[(2-oxo-3-phenylimidazol-1-yl)methyl]morpholin-4-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59376181 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-hydroxy-2-[2-[(2-oxo-3-phenylimidazol-1-yl)methyl]morpholin-4-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCOC(Cn3ccn(-c4ccccc4)c3=O)C2)nc1 |
| InChI | InChI=1S/C19H20N6O4/c26-17(22-28)14-10-20-18(21-11-14)23-8-9-29-16(12-23)13-24-6-7-25(19(24)27)15-4-2-1-3-5-15/h1-7,10-11,16,28H,8-9,12-13H2,(H,22,26) |
| InChIKey | JQZQDUTWQKBDEM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|