C30H37NO2 — CID 59382334
(3R,4R)-3-[[3-(4-methoxybutyl)-4-methylphenyl]methoxy]-4-(3-phenylphenyl)piperidine (PubChem CID 59382334) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is (3R,4R)-3-[[3-(4-methoxybutyl)-4-methylphenyl]methoxy]-4-(3-phenylphenyl)piperidine.
| Compound Name | (3R,4R)-3-[[3-(4-methoxybutyl)-4-methylphenyl]methoxy]-4-(3-phenylphenyl)piperidine |
|---|---|
| PubChem CID | 59382334 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | (3R,4R)-3-[[3-(4-methoxybutyl)-4-methylphenyl]methoxy]-4-(3-phenylphenyl)piperidine |
| SMILES | COCCCCc1cc(CO[C@H]2CNCC[C@@H]2c2cccc(-c3ccccc3)c2)ccc1C |
| InChI | InChI=1S/C30H37NO2/c1-23-14-15-24(19-26(23)11-6-7-18-32-2)22-33-30-21-31-17-16-29(30)28-13-8-12-27(20-28)25-9-4-3-5-10-25/h3-5,8-10,12-15,19-20,29-31H,6-7,11,16-18,21-22H2,1-2H3/t29-,30+/m1/s1 |
| InChIKey | CEEILYSZXPNHTL-IHLOFXLRSA-N |
| XLogP | 6.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|