C24H26ClNO — CID 67542732
(3R,4R)-3-phenylmethoxy-4-(3-phenylphenyl)piperidine;hydrochloride (PubChem CID 67542732) has the molecular formula C24H26ClNO and a molecular weight of 379.93 g/mol. Its IUPAC name is (3R,4R)-3-phenylmethoxy-4-(3-phenylphenyl)piperidine;hydrochloride.
| Compound Name | (3R,4R)-3-phenylmethoxy-4-(3-phenylphenyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 67542732 |
| Molecular Formula | C24H26ClNO |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (3R,4R)-3-phenylmethoxy-4-(3-phenylphenyl)piperidine;hydrochloride |
| SMILES | Cl.c1ccc(CO[C@H]2CNCC[C@@H]2c2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H25NO.ClH/c1-3-8-19(9-4-1)18-26-24-17-25-15-14-23(24)22-13-7-12-21(16-22)20-10-5-2-6-11-20;/h1-13,16,23-25H,14-15,17-18H2;1H/t23-,24+;/m1./s1 |
| InChIKey | QANFGLCDRZXRKL-ITNPDYSASA-N |
| XLogP | 5.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |