C30H32FN3O4S — CID 59385303
butyl (2S)-2-[[4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-2-methoxybenzoyl]amino]-3-methylbutanoate (PubChem CID 59385303) has the molecular formula C30H32FN3O4S and a molecular weight of 549.67 g/mol. Its IUPAC name is butyl (2S)-2-[[4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-2-methoxybenzoyl]amino]-3-methylbutanoate.
| Compound Name | butyl (2S)-2-[[4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-2-methoxybenzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 59385303 |
| Molecular Formula | C30H32FN3O4S |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | butyl (2S)-2-[[4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-2-methoxybenzoyl]amino]-3-methylbutanoate |
| SMILES | CCCCOC(=O)[C@@H](NC(=O)c1ccc(-c2ccc(Nc3nc4ccc(F)cc4s3)cc2)cc1OC)C(C)C |
| InChI | InChI=1S/C30H32FN3O4S/c1-5-6-15-38-29(36)27(18(2)3)34-28(35)23-13-9-20(16-25(23)37-4)19-7-11-22(12-8-19)32-30-33-24-14-10-21(31)17-26(24)39-30/h7-14,16-18,27H,5-6,15H2,1-4H3,(H,32,33)(H,34,35)/t27-/m0/s1 |
| InChIKey | MJNRXDXQLOIILH-MHZLTWQESA-N |
| XLogP | 6.95 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|