C25H23FN2O3S — CID 59385335
butyl 4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-2-methoxybenzoate (PubChem CID 59385335) has the molecular formula C25H23FN2O3S and a molecular weight of 450.54 g/mol. Its IUPAC name is butyl 4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-2-methoxybenzoate.
| Compound Name | butyl 4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 59385335 |
| Molecular Formula | C25H23FN2O3S |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | butyl 4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-2-methoxybenzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(Nc3nc4ccc(F)cc4s3)cc2)cc1OC |
| InChI | InChI=1S/C25H23FN2O3S/c1-3-4-13-31-24(29)20-11-7-17(14-22(20)30-2)16-5-9-19(10-6-16)27-25-28-21-12-8-18(26)15-23(21)32-25/h5-12,14-15H,3-4,13H2,1-2H3,(H,27,28) |
| InChIKey | GXYSVRRNKPMFNT-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|