C24H25F3Si — CID 59386273
[2,6-difluoro-4-(4-propylphenyl)phenyl]-[(4-fluorophenyl)methyl]-dimethylsilane (PubChem CID 59386273) has the molecular formula C24H25F3Si and a molecular weight of 398.54 g/mol. Its IUPAC name is [2,6-difluoro-4-(4-propylphenyl)phenyl]-[(4-fluorophenyl)methyl]-dimethylsilane.
| Compound Name | [2,6-difluoro-4-(4-propylphenyl)phenyl]-[(4-fluorophenyl)methyl]-dimethylsilane |
|---|---|
| PubChem CID | 59386273 |
| Molecular Formula | C24H25F3Si |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [2,6-difluoro-4-(4-propylphenyl)phenyl]-[(4-fluorophenyl)methyl]-dimethylsilane |
| SMILES | CCCc1ccc(-c2cc(F)c([Si](C)(C)Cc3ccc(F)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C24H25F3Si/c1-4-5-17-6-10-19(11-7-17)20-14-22(26)24(23(27)15-20)28(2,3)16-18-8-12-21(25)13-9-18/h6-15H,4-5,16H2,1-3H3 |
| InChIKey | NQQGSYYKVOMHFU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|