C10H9F11 — CID 59386457
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(2-methylpropyl)cyclohexane (PubChem CID 59386457) has the molecular formula C10H9F11 and a molecular weight of 338.16 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(2-methylpropyl)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(2-methylpropyl)cyclohexane |
|---|---|
| PubChem CID | 59386457 |
| Molecular Formula | C10H9F11 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(2-methylpropyl)cyclohexane |
| SMILES | CC(C)CC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H9F11/c1-4(2)3-5(11)6(12,13)8(16,17)10(20,21)9(18,19)7(5,14)15/h4H,3H2,1-2H3 |
| InChIKey | ZQGHTMQBHKPTPQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|