C28H29N3O3 — CID 59386925
3-[(2-amino-4-oxo-5,5-diphenyl-3H-pyrrol-3-yl)methyl]-N-(3-methoxypropyl)benzamide (PubChem CID 59386925) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[(2-amino-4-oxo-5,5-diphenyl-3H-pyrrol-3-yl)methyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-[(2-amino-4-oxo-5,5-diphenyl-3H-pyrrol-3-yl)methyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 59386925 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-[(2-amino-4-oxo-5,5-diphenyl-3H-pyrrol-3-yl)methyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cccc(CC2C(=O)C(c3ccccc3)(c3ccccc3)N=C2N)c1 |
| InChI | InChI=1S/C28H29N3O3/c1-34-17-9-16-30-27(33)21-11-8-10-20(18-21)19-24-25(32)28(31-26(24)29,22-12-4-2-5-13-22)23-14-6-3-7-15-23/h2-8,10-15,18,24H,9,16-17,19H2,1H3,(H2,29,31)(H,30,33) |
| InChIKey | XLHAIIAIRRCMAZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|