C20H18N4O3S2 — CID 59388330
N-[3-(2-amino-1-methyl-5-oxo-4-phenylimidazol-4-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 59388330) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[3-(2-amino-1-methyl-5-oxo-4-phenylimidazol-4-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(2-amino-1-methyl-5-oxo-4-phenylimidazol-4-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59388330 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[3-(2-amino-1-methyl-5-oxo-4-phenylimidazol-4-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | CN1C(=O)C(c2ccccc2)(c2cccc(NS(=O)(=O)c3cccs3)c2)N=C1N |
| InChI | InChI=1S/C20H18N4O3S2/c1-24-18(25)20(22-19(24)21,14-7-3-2-4-8-14)15-9-5-10-16(13-15)23-29(26,27)17-11-6-12-28-17/h2-13,23H,1H3,(H2,21,22) |
| InChIKey | UBXFJUUNFABXGO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |