C14H13F5N2O4 — CID 59389380
ethyl 4-(hydroxymethyl)-7-methoxy-2-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 59389380) has the molecular formula C14H13F5N2O4 and a molecular weight of 368.26 g/mol. Its IUPAC name is ethyl 4-(hydroxymethyl)-7-methoxy-2-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | ethyl 4-(hydroxymethyl)-7-methoxy-2-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59389380 |
| Molecular Formula | C14H13F5N2O4 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | ethyl 4-(hydroxymethyl)-7-methoxy-2-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)C(F)(F)F)nn2c(OC)ccc(CO)c12 |
| InChI | InChI=1S/C14H13F5N2O4/c1-3-25-12(23)9-10-7(6-22)4-5-8(24-2)21(10)20-11(9)13(15,16)14(17,18)19/h4-5,22H,3,6H2,1-2H3 |
| InChIKey | VCBCSCYPVDAFIW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|