C29H30FN3O5S — CID 59392722
4-[[2-fluoro-4-[3-[3-methoxy-4-(2-methoxyethoxy)phenyl]quinoxalin-5-yl]phenyl]methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 59392722) has the molecular formula C29H30FN3O5S and a molecular weight of 551.64 g/mol. Its IUPAC name is 4-[[2-fluoro-4-[3-[3-methoxy-4-(2-methoxyethoxy)phenyl]quinoxalin-5-yl]phenyl]methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[[2-fluoro-4-[3-[3-methoxy-4-(2-methoxyethoxy)phenyl]quinoxalin-5-yl]phenyl]methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 59392722 |
| Molecular Formula | C29H30FN3O5S |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 4-[[2-fluoro-4-[3-[3-methoxy-4-(2-methoxyethoxy)phenyl]quinoxalin-5-yl]phenyl]methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | COCCOc1ccc(-c2cnc3cccc(-c4ccc(CN5CCS(=O)(=O)CC5)c(F)c4)c3n2)cc1OC |
| InChI | InChI=1S/C29H30FN3O5S/c1-36-12-13-38-27-9-8-21(17-28(27)37-2)26-18-31-25-5-3-4-23(29(25)32-26)20-6-7-22(24(30)16-20)19-33-10-14-39(34,35)15-11-33/h3-9,16-18H,10-15,19H2,1-2H3 |
| InChIKey | SHEFFLURGBYZLS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|