C29H32N4O3 — CID 59393275
5-[2-cyano-2-(3-ethyl-2-oxo-1H-quinolin-7-yl)propyl]-2-(3-morpholin-4-ylpropoxy)benzonitrile (PubChem CID 59393275) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 5-[2-cyano-2-(3-ethyl-2-oxo-1H-quinolin-7-yl)propyl]-2-(3-morpholin-4-ylpropoxy)benzonitrile.
| Compound Name | 5-[2-cyano-2-(3-ethyl-2-oxo-1H-quinolin-7-yl)propyl]-2-(3-morpholin-4-ylpropoxy)benzonitrile |
|---|---|
| PubChem CID | 59393275 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 5-[2-cyano-2-(3-ethyl-2-oxo-1H-quinolin-7-yl)propyl]-2-(3-morpholin-4-ylpropoxy)benzonitrile |
| SMILES | CCc1cc2ccc(C(C)(C#N)Cc3ccc(OCCCN4CCOCC4)c(C#N)c3)cc2[nH]c1=O |
| InChI | InChI=1S/C29H32N4O3/c1-3-22-16-23-6-7-25(17-26(23)32-28(22)34)29(2,20-31)18-21-5-8-27(24(15-21)19-30)36-12-4-9-33-10-13-35-14-11-33/h5-8,15-17H,3-4,9-14,18H2,1-2H3,(H,32,34) |
| InChIKey | JAIRSJSYKOFMHZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|