C30H34N4O3 — CID 59393342
5-[2-cyano-2-(3-ethyl-2-methoxyquinolin-7-yl)propyl]-2-(3-morpholin-4-ylpropoxy)benzonitrile (PubChem CID 59393342) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 5-[2-cyano-2-(3-ethyl-2-methoxyquinolin-7-yl)propyl]-2-(3-morpholin-4-ylpropoxy)benzonitrile.
| Compound Name | 5-[2-cyano-2-(3-ethyl-2-methoxyquinolin-7-yl)propyl]-2-(3-morpholin-4-ylpropoxy)benzonitrile |
|---|---|
| PubChem CID | 59393342 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 5-[2-cyano-2-(3-ethyl-2-methoxyquinolin-7-yl)propyl]-2-(3-morpholin-4-ylpropoxy)benzonitrile |
| SMILES | CCc1cc2ccc(C(C)(C#N)Cc3ccc(OCCCN4CCOCC4)c(C#N)c3)cc2nc1OC |
| InChI | InChI=1S/C30H34N4O3/c1-4-23-17-24-7-8-26(18-27(24)33-29(23)35-3)30(2,21-32)19-22-6-9-28(25(16-22)20-31)37-13-5-10-34-11-14-36-15-12-34/h6-9,16-18H,4-5,10-15,19H2,1-3H3 |
| InChIKey | ZVFHTHRSEQSAHE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 91.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|