C22H22N2O2 — CID 59392990
2-(3-ethyl-2-methoxyquinolin-7-yl)-3-(3-hydroxyphenyl)-2-methylpropanenitrile (PubChem CID 59392990) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(3-ethyl-2-methoxyquinolin-7-yl)-3-(3-hydroxyphenyl)-2-methylpropanenitrile.
| Compound Name | 2-(3-ethyl-2-methoxyquinolin-7-yl)-3-(3-hydroxyphenyl)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 59392990 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-(3-ethyl-2-methoxyquinolin-7-yl)-3-(3-hydroxyphenyl)-2-methylpropanenitrile |
| SMILES | CCc1cc2ccc(C(C)(C#N)Cc3cccc(O)c3)cc2nc1OC |
| InChI | InChI=1S/C22H22N2O2/c1-4-16-11-17-8-9-18(12-20(17)24-21(16)26-3)22(2,14-23)13-15-6-5-7-19(25)10-15/h5-12,25H,4,13H2,1-3H3 |
| InChIKey | AABOUMGVULKIBC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |