C24H21N3O3 — CID 59393229
3-(1,3-dioxoisoindol-2-yl)-2-(3-ethyl-2-methoxyquinolin-7-yl)-2-methylpropanenitrile (PubChem CID 59393229) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-2-(3-ethyl-2-methoxyquinolin-7-yl)-2-methylpropanenitrile.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-2-(3-ethyl-2-methoxyquinolin-7-yl)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 59393229 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-2-(3-ethyl-2-methoxyquinolin-7-yl)-2-methylpropanenitrile |
| SMILES | CCc1cc2ccc(C(C)(C#N)CN3C(=O)c4ccccc4C3=O)cc2nc1OC |
| InChI | InChI=1S/C24H21N3O3/c1-4-15-11-16-9-10-17(12-20(16)26-21(15)30-3)24(2,13-25)14-27-22(28)18-7-5-6-8-19(18)23(27)29/h5-12H,4,14H2,1-3H3 |
| InChIKey | DATABPUMONWDSR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|