C23H25IN2O — CID 145469826
(5Z,7E)-2-(3-ethyl-2-methoxyquinolin-7-yl)-8-iodo-2-methyl-4-methylidenenona-5,7-dienenitrile (PubChem CID 145469826) has the molecular formula C23H25IN2O and a molecular weight of 472.37 g/mol. Its IUPAC name is (5Z,7E)-2-(3-ethyl-2-methoxyquinolin-7-yl)-8-iodo-2-methyl-4-methylidenenona-5,7-dienenitrile.
| Compound Name | (5Z,7E)-2-(3-ethyl-2-methoxyquinolin-7-yl)-8-iodo-2-methyl-4-methylidenenona-5,7-dienenitrile |
|---|---|
| PubChem CID | 145469826 |
| Molecular Formula | C23H25IN2O |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (5Z,7E)-2-(3-ethyl-2-methoxyquinolin-7-yl)-8-iodo-2-methyl-4-methylidenenona-5,7-dienenitrile |
| SMILES | C=C(/C=C\C=C(/C)I)CC(C)(C#N)c1ccc2cc(CC)c(OC)nc2c1 |
| InChI | InChI=1S/C23H25IN2O/c1-6-18-12-19-10-11-20(13-21(19)26-22(18)27-5)23(4,15-25)14-16(2)8-7-9-17(3)24/h7-13H,2,6,14H2,1,3-5H3/b8-7-,17-9+ |
| InChIKey | NZWBJAZXZOPHDA-BNWIPASCSA-N |
| XLogP | 6.43 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|