C26H20F2N4O2 — CID 59399357
N-benzoyl-6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxamide (PubChem CID 59399357) has the molecular formula C26H20F2N4O2 and a molecular weight of 458.47 g/mol. Its IUPAC name is N-benzoyl-6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxamide.
| Compound Name | N-benzoyl-6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59399357 |
| Molecular Formula | C26H20F2N4O2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-benzoyl-6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxamide |
| SMILES | CC(C)(c1cccc(C(=O)NC(=O)c2ccccc2)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C26H20F2N4O2/c1-26(2,20-12-6-10-18(29-20)17-14-15-22(27)31-23(17)28)21-13-7-11-19(30-21)25(34)32-24(33)16-8-4-3-5-9-16/h3-15H,1-2H3,(H,32,33,34) |
| InChIKey | CRNRTOJYNXHSLK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|