C20H13F5N4OPt — CID 59399395
[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(trifluoromethyl)azanide;platinum(2+) (PubChem CID 59399395) has the molecular formula C20H13F5N4OPt and a molecular weight of 615.42 g/mol. Its IUPAC name is [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(trifluoromethyl)azanide;platinum(2+).
| Compound Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(trifluoromethyl)azanide;platinum(2+) |
|---|---|
| PubChem CID | 59399395 |
| Molecular Formula | C20H13F5N4OPt |
| Molecular Weight | 615.42 g/mol |
| Exact Mass | 615.07 |
| IUPAC Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(trifluoromethyl)azanide;platinum(2+) |
| SMILES | CC(C)(c1cccc(C(=O)[N-]C(F)(F)F)n1)c1cccc(-c2[c-]cc(F)nc2F)n1.[Pt+2] |
| InChI | InChI=1S/C20H14F5N4O.Pt/c1-19(2,15-8-4-6-13(27-15)18(30)29-20(23,24)25)14-7-3-5-12(26-14)11-9-10-16(21)28-17(11)22;/h3-8,10H,1-2H3,(H,29,30);/q-1;+2/p-1 |
| InChIKey | FPCYQRXRFIQMNQ-UHFFFAOYSA-M |
| XLogP | 4.97 |
| TPSA | 69.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|