C20H13F5N4O3PtS — CID 59399210
[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(trifluoromethylsulfonyl)azanide;platinum(2+) (PubChem CID 59399210) has the molecular formula C20H13F5N4O3PtS and a molecular weight of 679.48 g/mol. Its IUPAC name is [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(trifluoromethylsulfonyl)azanide;platinum(2+).
| Compound Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(trifluoromethylsulfonyl)azanide;platinum(2+) |
|---|---|
| PubChem CID | 59399210 |
| Molecular Formula | C20H13F5N4O3PtS |
| Molecular Weight | 679.48 g/mol |
| Exact Mass | 679.03 |
| IUPAC Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(trifluoromethylsulfonyl)azanide;platinum(2+) |
| SMILES | CC(C)(c1cccc(C(=O)[N-]S(=O)(=O)C(F)(F)F)n1)c1cccc(-c2[c-]cc(F)nc2F)n1.[Pt+2] |
| InChI | InChI=1S/C20H14F5N4O3S.Pt/c1-19(2,14-7-3-5-12(26-14)11-9-10-16(21)28-17(11)22)15-8-4-6-13(27-15)18(30)29-33(31,32)20(23,24)25;/h3-8,10H,1-2H3,(H,29,30);/q-1;+2/p-1 |
| InChIKey | YHEZBRCPBQWUNK-UHFFFAOYSA-M |
| XLogP | 4.30 |
| TPSA | 103.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|