C20H15F5N4O3S — CID 59399211
6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(trifluoromethylsulfonyl)pyridine-2-carboxamide (PubChem CID 59399211) has the molecular formula C20H15F5N4O3S and a molecular weight of 486.42 g/mol. Its IUPAC name is 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(trifluoromethylsulfonyl)pyridine-2-carboxamide.
| Compound Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(trifluoromethylsulfonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59399211 |
| Molecular Formula | C20H15F5N4O3S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(trifluoromethylsulfonyl)pyridine-2-carboxamide |
| SMILES | CC(C)(c1cccc(C(=O)NS(=O)(=O)C(F)(F)F)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C20H15F5N4O3S/c1-19(2,14-7-3-5-12(26-14)11-9-10-16(21)28-17(11)22)15-8-4-6-13(27-15)18(30)29-33(31,32)20(23,24)25/h3-10H,1-2H3,(H,29,30) |
| InChIKey | BSHYRCAOZVVIOT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|