C20H16F2N4O3PtS — CID 59399073
[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-methylsulfonylazanide;platinum(2+) (PubChem CID 59399073) has the molecular formula C20H16F2N4O3PtS and a molecular weight of 625.51 g/mol. Its IUPAC name is [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-methylsulfonylazanide;platinum(2+).
| Compound Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-methylsulfonylazanide;platinum(2+) |
|---|---|
| PubChem CID | 59399073 |
| Molecular Formula | C20H16F2N4O3PtS |
| Molecular Weight | 625.51 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-methylsulfonylazanide;platinum(2+) |
| SMILES | CC(C)(c1cccc(C(=O)[N-]S(C)(=O)=O)n1)c1cccc(-c2[c-]cc(F)nc2F)n1.[Pt+2] |
| InChI | InChI=1S/C20H17F2N4O3S.Pt/c1-20(2,16-9-5-7-14(24-16)19(27)26-30(3,28)29)15-8-4-6-13(23-15)12-10-11-17(21)25-18(12)22;/h4-9,11H,1-3H3,(H,26,27);/q-1;+2/p-1 |
| InChIKey | KTESWEIQGQAMKZ-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 103.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|