C21H13F2N3OPtS — CID 59342139
6-[2-[6-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbothioate;platinum(2+) (PubChem CID 59342139) has the molecular formula C21H13F2N3OPtS and a molecular weight of 588.50 g/mol. Its IUPAC name is 6-[2-[6-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbothioate;platinum(2+).
| Compound Name | 6-[2-[6-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbothioate;platinum(2+) |
|---|---|
| PubChem CID | 59342139 |
| Molecular Formula | C21H13F2N3OPtS |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | 6-[2-[6-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbothioate;platinum(2+) |
| SMILES | [C-]#[N+]c1c(F)c[c-]c(-c2cccc(C(C)(C)c3cccc(C(=O)[S-])n3)n2)c1F.[Pt+2] |
| InChI | InChI=1S/C21H14F2N3OS.Pt/c1-21(2,17-9-5-7-15(26-17)20(27)28)16-8-4-6-14(25-16)12-10-11-13(22)19(24-3)18(12)23;/h4-9,11H,1-2H3,(H,27,28);/q-1;+2/p-1 |
| InChIKey | OLPBQNRTYAKOFH-UHFFFAOYSA-M |
| XLogP | 4.78 |
| TPSA | 47.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|