C32H26F2N4O3S — CID 59399346
6-[2-[6-(2,6-difluoro-3-pyridinyl)-4-phenyl-2-pyridinyl]propan-2-yl]-N-methylsulfonyl-4-phenylpyridine-2-carboxamide (PubChem CID 59399346) has the molecular formula C32H26F2N4O3S and a molecular weight of 584.65 g/mol. Its IUPAC name is 6-[2-[6-(2,6-difluoro-3-pyridinyl)-4-phenyl-2-pyridinyl]propan-2-yl]-N-methylsulfonyl-4-phenylpyridine-2-carboxamide.
| Compound Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-4-phenyl-2-pyridinyl]propan-2-yl]-N-methylsulfonyl-4-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 59399346 |
| Molecular Formula | C32H26F2N4O3S |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-4-phenyl-2-pyridinyl]propan-2-yl]-N-methylsulfonyl-4-phenylpyridine-2-carboxamide |
| SMILES | CC(C)(c1cc(-c2ccccc2)cc(C(=O)NS(C)(=O)=O)n1)c1cc(-c2ccccc2)cc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C32H26F2N4O3S/c1-32(2,28-19-23(21-12-8-5-9-13-21)17-26(36-28)31(39)38-42(3,40)41)27-18-22(20-10-6-4-7-11-20)16-25(35-27)24-14-15-29(33)37-30(24)34/h4-19H,1-3H3,(H,38,39) |
| InChIKey | NMZYBFSSNACYBY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|