C21H18F2N4O2 — CID 59399453
N-acetyl-6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxamide (PubChem CID 59399453) has the molecular formula C21H18F2N4O2 and a molecular weight of 396.40 g/mol. Its IUPAC name is N-acetyl-6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxamide.
| Compound Name | N-acetyl-6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59399453 |
| Molecular Formula | C21H18F2N4O2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-acetyl-6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxamide |
| SMILES | CC(=O)NC(=O)c1cccc(C(C)(C)c2cccc(-c3ccc(F)nc3F)n2)n1 |
| InChI | InChI=1S/C21H18F2N4O2/c1-12(28)24-20(29)15-7-5-9-17(26-15)21(2,3)16-8-4-6-14(25-16)13-10-11-18(22)27-19(13)23/h4-11H,1-3H3,(H,24,28,29) |
| InChIKey | JPTPNIHVRHWDCE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|