C20H15F5N4O — CID 59399396
6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 59399396) has the molecular formula C20H15F5N4O and a molecular weight of 422.36 g/mol. Its IUPAC name is 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59399396 |
| Molecular Formula | C20H15F5N4O |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CC(C)(c1cccc(C(=O)NC(F)(F)F)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C20H15F5N4O/c1-19(2,15-8-4-6-13(27-15)18(30)29-20(23,24)25)14-7-3-5-12(26-14)11-9-10-16(21)28-17(11)22/h3-10H,1-2H3,(H,29,30) |
| InChIKey | KJTYJKZHEUIREU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|