C28H24F2N4OPt — CID 59399136
[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(2-phenylpropan-2-yl)azanide;platinum(2+) (PubChem CID 59399136) has the molecular formula C28H24F2N4OPt and a molecular weight of 665.60 g/mol. Its IUPAC name is [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(2-phenylpropan-2-yl)azanide;platinum(2+).
| Compound Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(2-phenylpropan-2-yl)azanide;platinum(2+) |
|---|---|
| PubChem CID | 59399136 |
| Molecular Formula | C28H24F2N4OPt |
| Molecular Weight | 665.60 g/mol |
| Exact Mass | 665.16 |
| IUPAC Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]-(2-phenylpropan-2-yl)azanide;platinum(2+) |
| SMILES | CC(C)([N-]C(=O)c1cccc(C(C)(C)c2cccc(-c3[c-]cc(F)nc3F)n2)n1)c1ccccc1.[Pt+2] |
| InChI | InChI=1S/C28H25F2N4O.Pt/c1-27(2,22-14-8-12-20(31-22)19-16-17-24(29)33-25(19)30)23-15-9-13-21(32-23)26(35)34-28(3,4)18-10-6-5-7-11-18;/h5-15,17H,1-4H3,(H,34,35);/q-1;+2/p-1 |
| InChIKey | BGXCMHKDRVZURK-UHFFFAOYSA-M |
| XLogP | 6.39 |
| TPSA | 69.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|