C25H20N4OPt — CID 59399250
phenyl-[6-[2-[6-(4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]azanide;platinum(2+) (PubChem CID 59399250) has the molecular formula C25H20N4OPt and a molecular weight of 587.54 g/mol. Its IUPAC name is phenyl-[6-[2-[6-(4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]azanide;platinum(2+).
| Compound Name | phenyl-[6-[2-[6-(4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]azanide;platinum(2+) |
|---|---|
| PubChem CID | 59399250 |
| Molecular Formula | C25H20N4OPt |
| Molecular Weight | 587.54 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | phenyl-[6-[2-[6-(4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carbonyl]azanide;platinum(2+) |
| SMILES | CC(C)(c1cccc(C(=O)[N-]c2ccccc2)n1)c1cccc(-c2[c-]ccnc2)n1.[Pt+2] |
| InChI | InChI=1S/C25H21N4O.Pt/c1-25(2,22-14-6-12-20(28-22)18-9-8-16-26-17-18)23-15-7-13-21(29-23)24(30)27-19-10-4-3-5-11-19;/h3-8,10-17H,1-2H3,(H,27,30);/q-1;+2/p-1 |
| InChIKey | FRMAPMGTAIHTFV-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 69.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|