C25H20F2N4OS — CID 59399456
6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-phenylsulfanylpyridine-2-carboxamide (PubChem CID 59399456) has the molecular formula C25H20F2N4OS and a molecular weight of 462.53 g/mol. Its IUPAC name is 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-phenylsulfanylpyridine-2-carboxamide.
| Compound Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-phenylsulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 59399456 |
| Molecular Formula | C25H20F2N4OS |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-phenylsulfanylpyridine-2-carboxamide |
| SMILES | CC(C)(c1cccc(C(=O)NSc2ccccc2)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C25H20F2N4OS/c1-25(2,20-12-6-10-18(28-20)17-14-15-22(26)30-23(17)27)21-13-7-11-19(29-21)24(32)31-33-16-8-4-3-5-9-16/h3-15H,1-2H3,(H,31,32) |
| InChIKey | IFGKNFRVCKISFF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|