C27H33N3O2 — CID 59401364
6-[5-[[(4-tert-butylcyclohexyl)amino]methyl]naphthalen-1-yl]oxypyridine-3-carboxamide (PubChem CID 59401364) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 6-[5-[[(4-tert-butylcyclohexyl)amino]methyl]naphthalen-1-yl]oxypyridine-3-carboxamide.
| Compound Name | 6-[5-[[(4-tert-butylcyclohexyl)amino]methyl]naphthalen-1-yl]oxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 59401364 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 6-[5-[[(4-tert-butylcyclohexyl)amino]methyl]naphthalen-1-yl]oxypyridine-3-carboxamide |
| SMILES | CC(C)(C)C1CCC(NCc2cccc3c(Oc4ccc(C(N)=O)cn4)cccc23)CC1 |
| InChI | InChI=1S/C27H33N3O2/c1-27(2,3)20-11-13-21(14-12-20)29-16-18-6-4-8-23-22(18)7-5-9-24(23)32-25-15-10-19(17-30-25)26(28)31/h4-10,15,17,20-21,29H,11-14,16H2,1-3H3,(H2,28,31) |
| InChIKey | CORRDUNNLLZGTA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |