C24H26F3IrN2O3- — CID 59408499
3,5-dimethyl-2-(3-phenylmethoxybenzene-6-id-1-yl)pyrazine;iridium;1,1,1-trifluoropentane-2,4-diol (PubChem CID 59408499) has the molecular formula C24H26F3IrN2O3- and a molecular weight of 639.69 g/mol. Its IUPAC name is 3,5-dimethyl-2-(3-phenylmethoxybenzene-6-id-1-yl)pyrazine;iridium;1,1,1-trifluoropentane-2,4-diol.
| Compound Name | 3,5-dimethyl-2-(3-phenylmethoxybenzene-6-id-1-yl)pyrazine;iridium;1,1,1-trifluoropentane-2,4-diol |
|---|---|
| PubChem CID | 59408499 |
| Molecular Formula | C24H26F3IrN2O3- |
| Molecular Weight | 639.69 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | 3,5-dimethyl-2-(3-phenylmethoxybenzene-6-id-1-yl)pyrazine;iridium;1,1,1-trifluoropentane-2,4-diol |
| SMILES | CC(O)CC(O)C(F)(F)F.Cc1cnc(-c2[c-]ccc(OCc3ccccc3)c2)c(C)n1.[Ir] |
| InChI | InChI=1S/C19H17N2O.C5H9F3O2.Ir/c1-14-12-20-19(15(2)21-14)17-9-6-10-18(11-17)22-13-16-7-4-3-5-8-16;1-3(9)2-4(10)5(6,7)8;/h3-8,10-12H,13H2,1-2H3;3-4,9-10H,2H2,1H3;/q-1;; |
| InChIKey | TYBJNAFCOOQFJY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|