C23H27IrN2O2- — CID 58894480
3,5-dimethyl-2-(4-phenylbenzene-6-id-1-yl)pyrazine;iridium;pentane-2,4-diol (PubChem CID 58894480) has the molecular formula C23H27IrN2O2- and a molecular weight of 555.70 g/mol. Its IUPAC name is 3,5-dimethyl-2-(4-phenylbenzene-6-id-1-yl)pyrazine;iridium;pentane-2,4-diol.
| Compound Name | 3,5-dimethyl-2-(4-phenylbenzene-6-id-1-yl)pyrazine;iridium;pentane-2,4-diol |
|---|---|
| PubChem CID | 58894480 |
| Molecular Formula | C23H27IrN2O2- |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 3,5-dimethyl-2-(4-phenylbenzene-6-id-1-yl)pyrazine;iridium;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Cc1cnc(-c2[c-]cc(-c3ccccc3)cc2)c(C)n1.[Ir] |
| InChI | InChI=1S/C18H15N2.C5H12O2.Ir/c1-13-12-19-18(14(2)20-13)17-10-8-16(9-11-17)15-6-4-3-5-7-15;1-4(6)3-5(2)7;/h3-10,12H,1-2H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | SKDTZADKGITDPD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|