C22H25IrN2O2- — CID 58894499
iridium;2-methyl-3-(4-phenylbenzene-6-id-1-yl)pyrazine;pentane-2,4-diol (PubChem CID 58894499) has the molecular formula C22H25IrN2O2- and a molecular weight of 541.67 g/mol. Its IUPAC name is iridium;2-methyl-3-(4-phenylbenzene-6-id-1-yl)pyrazine;pentane-2,4-diol.
| Compound Name | iridium;2-methyl-3-(4-phenylbenzene-6-id-1-yl)pyrazine;pentane-2,4-diol |
|---|---|
| PubChem CID | 58894499 |
| Molecular Formula | C22H25IrN2O2- |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | iridium;2-methyl-3-(4-phenylbenzene-6-id-1-yl)pyrazine;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Cc1nccnc1-c1[c-]cc(-c2ccccc2)cc1.[Ir] |
| InChI | InChI=1S/C17H13N2.C5H12O2.Ir/c1-13-17(19-12-11-18-13)16-9-7-15(8-10-16)14-5-3-2-4-6-14;1-4(6)3-5(2)7;/h2-9,11-12H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | RFWVTTWUUVHYIS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|