C21H46NO4+ — CID 59411742
4,4-bis(2-propoxyethoxy)butyl-dimethyl-(2-methylbutyl)azanium (PubChem CID 59411742) has the molecular formula C21H46NO4+ and a molecular weight of 376.60 g/mol. Its IUPAC name is 4,4-bis(2-propoxyethoxy)butyl-dimethyl-(2-methylbutyl)azanium.
| Compound Name | 4,4-bis(2-propoxyethoxy)butyl-dimethyl-(2-methylbutyl)azanium |
|---|---|
| PubChem CID | 59411742 |
| Molecular Formula | C21H46NO4+ |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.34 |
| IUPAC Name | 4,4-bis(2-propoxyethoxy)butyl-dimethyl-(2-methylbutyl)azanium |
| SMILES | CCCOCCOC(CCC[N+](C)(C)CC(C)CC)OCCOCCC |
| InChI | InChI=1S/C21H46NO4/c1-7-13-23-15-17-25-21(26-18-16-24-14-8-2)11-10-12-22(5,6)19-20(4)9-3/h20-21H,7-19H2,1-6H3/q+1 |
| InChIKey | MOEHDFLFYUPPMB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|