C15H17N4SY- — CID 59414092
2-methyl-9-(2-methylpropyl)-8-(thiophen-2-ylmethyl)purine;yttrium (PubChem CID 59414092) has the molecular formula C15H17N4SY- and a molecular weight of 374.30 g/mol. Its IUPAC name is 2-methyl-9-(2-methylpropyl)-8-(thiophen-2-ylmethyl)purine;yttrium.
| Compound Name | 2-methyl-9-(2-methylpropyl)-8-(thiophen-2-ylmethyl)purine;yttrium |
|---|---|
| PubChem CID | 59414092 |
| Molecular Formula | C15H17N4SY- |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-methyl-9-(2-methylpropyl)-8-(thiophen-2-ylmethyl)purine;yttrium |
| SMILES | Cc1ncc2nc(Cc3cccs3)n(C[C-](C)C)c2n1.[Y] |
| InChI | InChI=1S/C15H17N4S.Y/c1-10(2)9-19-14(7-12-5-4-6-20-12)18-13-8-16-11(3)17-15(13)19;/h4-6,8H,7,9H2,1-3H3;/q-1; |
| InChIKey | WZEDUPKAHIMIBK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|