C23H23F5N4O3 — CID 59415134
(2,2,3,3-tetrafluorocyclobutyl) 2-amino-3-[cyclobutyl-(4-fluorophenyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 59415134) has the molecular formula C23H23F5N4O3 and a molecular weight of 498.45 g/mol. Its IUPAC name is (2,2,3,3-tetrafluorocyclobutyl) 2-amino-3-[cyclobutyl-(4-fluorophenyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | (2,2,3,3-tetrafluorocyclobutyl) 2-amino-3-[cyclobutyl-(4-fluorophenyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 59415134 |
| Molecular Formula | C23H23F5N4O3 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (2,2,3,3-tetrafluorocyclobutyl) 2-amino-3-[cyclobutyl-(4-fluorophenyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | Nc1nc2c(c(=O)n1C(c1ccc(F)cc1)C1CCC1)CCN(C(=O)OC1CC(F)(F)C1(F)F)C2 |
| InChI | InChI=1S/C23H23F5N4O3/c24-14-6-4-13(5-7-14)18(12-2-1-3-12)32-19(33)15-8-9-31(11-16(15)30-20(32)29)21(34)35-17-10-22(25,26)23(17,27)28/h4-7,12,17-18H,1-3,8-11H2,(H2,29,30) |
| InChIKey | SOWIOTPCQWUBHF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|