C30H42N4O4 — CID 59415532
(2S)-N,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]-N-[(2S)-1-oxo-3-phenylmethoxy-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]butanamide (PubChem CID 59415532) has the molecular formula C30H42N4O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is (2S)-N,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]-N-[(2S)-1-oxo-3-phenylmethoxy-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]butanamide.
| Compound Name | (2S)-N,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]-N-[(2S)-1-oxo-3-phenylmethoxy-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 59415532 |
| Molecular Formula | C30H42N4O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | (2S)-N,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]-N-[(2S)-1-oxo-3-phenylmethoxy-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]butanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N(C)[C@@H](COCc1ccccc1)C(=O)NC1CCCc2ccccc21)C(C)C |
| InChI | InChI=1S/C30H42N4O4/c1-20(2)27(33-28(35)21(3)31-4)30(37)34(5)26(19-38-18-22-12-7-6-8-13-22)29(36)32-25-17-11-15-23-14-9-10-16-24(23)25/h6-10,12-14,16,20-21,25-27,31H,11,15,17-19H2,1-5H3,(H,32,36)(H,33,35)/t21-,25?,26-,27-/m0/s1 |
| InChIKey | BBIVUIBTDLKQDO-PCMJLEAHSA-N |
| XLogP | 2.97 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |