C26H25N3O4S — CID 59417273
N-[(1S)-2-(hydroxyamino)-2-oxo-1-thiophen-3-ylethyl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide (PubChem CID 59417273) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[(1S)-2-(hydroxyamino)-2-oxo-1-thiophen-3-ylethyl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide.
| Compound Name | N-[(1S)-2-(hydroxyamino)-2-oxo-1-thiophen-3-ylethyl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59417273 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[(1S)-2-(hydroxyamino)-2-oxo-1-thiophen-3-ylethyl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide |
| SMILES | O=C(N[C@H](C(=O)NO)c1ccsc1)c1ccc(C#Cc2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O4S/c30-25(27-24(26(31)28-32)23-11-16-34-18-23)22-9-7-20(8-10-22)2-1-19-3-5-21(6-4-19)17-29-12-14-33-15-13-29/h3-11,16,18,24,32H,12-15,17H2,(H,27,30)(H,28,31)/t24-/m0/s1 |
| InChIKey | OHEJDUQNJHGNNP-DEOSSOPVSA-N |
| XLogP | 2.96 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|