C34H35N7O6S2 — CID 59421042
N-hydroxy-2-[4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]-4-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide (PubChem CID 59421042) has the molecular formula C34H35N7O6S2 and a molecular weight of 701.83 g/mol. Its IUPAC name is N-hydroxy-2-[4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]-4-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]-4-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59421042 |
| Molecular Formula | C34H35N7O6S2 |
| Molecular Weight | 701.83 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | N-hydroxy-2-[4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]-4-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCC(NS(=O)(=O)c3ccc4ccccc4c3)CC2)nc1N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C34H35N7O6S2/c42-33(37-43)31-23-35-34(40-15-13-28(14-16-40)38-48(44,45)29-11-9-24-5-1-3-7-26(24)21-29)36-32(31)39-17-19-41(20-18-39)49(46,47)30-12-10-25-6-2-4-8-27(25)22-30/h1-12,21-23,28,38,43H,13-20H2,(H,37,42) |
| InChIKey | CIQQDTXMWWJNIJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|