C21H21N5O4S — CID 52945663
2-[(3aS,6aR)-5-naphthalen-2-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 52945663) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-naphthalen-2-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[(3aS,6aR)-5-naphthalen-2-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 52945663 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-[(3aS,6aR)-5-naphthalen-2-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2C[C@@H]3CN(S(=O)(=O)c4ccc5ccccc5c4)C[C@@H]3C2)nc1 |
| InChI | InChI=1S/C21H21N5O4S/c27-20(24-28)16-8-22-21(23-9-16)25-10-17-12-26(13-18(17)11-25)31(29,30)19-6-5-14-3-1-2-4-15(14)7-19/h1-9,17-18,28H,10-13H2,(H,24,27)/t17-,18+ |
| InChIKey | PRIUJKXYEBCDBF-HDICACEKSA-N |
| XLogP | 1.51 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|