C17H14F5N7O — CID 59422178
(2S,4S)-4-fluoro-1-[4-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 59422178) has the molecular formula C17H14F5N7O and a molecular weight of 427.34 g/mol. Its IUPAC name is (2S,4S)-4-fluoro-1-[4-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-fluoro-1-[4-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59422178 |
| Molecular Formula | C17H14F5N7O |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (2S,4S)-4-fluoro-1-[4-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@@H]1C[C@H](F)CN1c1ncnc(-c2c[nH]c3ncc(F)cc23)n1 |
| InChI | InChI=1S/C17H14F5N7O/c18-8-1-10-11(4-24-13(10)23-3-8)14-26-7-27-16(28-14)29-5-9(19)2-12(29)15(30)25-6-17(20,21)22/h1,3-4,7,9,12H,2,5-6H2,(H,23,24)(H,25,30)/t9-,12-/m0/s1 |
| InChIKey | HJNQVTDYHALZAB-CABZTGNLSA-N |
| XLogP | 2.15 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |