C39H37F3O5 — CID 59422860
1-[4-[[(1R)-1-[(2R)-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),3,5,7,16,18(23)-hexaen-13-yl]-2,2,2-trifluoro-1-phenylethyl]peroxymethyl]phenyl]propan-2-one (PubChem CID 59422860) has the molecular formula C39H37F3O5 and a molecular weight of 642.71 g/mol. Its IUPAC name is 1-[4-[[(1R)-1-[(2R)-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),3,5,7,16,18(23)-hexaen-13-yl]-2,2,2-trifluoro-1-phenylethyl]peroxymethyl]phenyl]propan-2-one.
| Compound Name | 1-[4-[[(1R)-1-[(2R)-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),3,5,7,16,18(23)-hexaen-13-yl]-2,2,2-trifluoro-1-phenylethyl]peroxymethyl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 59422860 |
| Molecular Formula | C39H37F3O5 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | 1-[4-[[(1R)-1-[(2R)-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),3,5,7,16,18(23)-hexaen-13-yl]-2,2,2-trifluoro-1-phenylethyl]peroxymethyl]phenyl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(COO[C@](c2ccccc2)(C2Oc3ccc4c(c3[C@H]3c5ccccc5CCC3O2)CCCC4)C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H37F3O5/c1-25(43)23-26-15-17-27(18-16-26)24-44-47-38(39(40,41)42,30-11-3-2-4-12-30)37-45-33-21-19-28-9-5-7-13-31(28)35(33)36-32-14-8-6-10-29(32)20-22-34(36)46-37/h2-5,7,9,11-13,15-18,20,22,33,35,37H,6,8,10,14,19,21,23-24H2,1H3/t33?,35-,37?,38+/m0/s1 |
| InChIKey | ZZXDWHBACHCMFL-XCYXCWHSSA-N |
| XLogP | 8.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|